About (E)-3-bromo-N,N-dimethylprop-2-en-1-amine
(E)-3-bromo-N,N-dimethylprop-2-en-1-amine (PubChem CID 23271071) has the molecular formula C5H10BrN
and a molecular weight of 164.05 g/mol. Its IUPAC name is (E)-3-bromo-N,N-dimethylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-3-bromo-N,N-dimethylprop-2-en-1-amine |
| PubChem CID | 23271071 |
| Molecular Formula | C5H10BrN |
| Molecular Weight | 164.05 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | (E)-3-bromo-N,N-dimethylprop-2-en-1-amine |
| SMILES | CN(C)C/C=C/Br |
| InChI | InChI=1S/C5H10BrN/c1-7(2)5-3-4-6/h3-4H,5H2,1-2H3/b4-3+ |
| InChIKey | IQUZWVSCEFCUJB-ONEGZZNKSA-N |
| XLogP | 1.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.05 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-3-bromo-N,N-dimethylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-bromo-N,N-dimethylprop-2-en-1-amine?
The IUPAC name of (E)-3-bromo-N,N-dimethylprop-2-en-1-amine (CID 23271071) is (E)-3-bromo-N,N-dimethylprop-2-en-1-amine.
What is the SMILES notation for (E)-3-bromo-N,N-dimethylprop-2-en-1-amine?
The canonical SMILES for (E)-3-bromo-N,N-dimethylprop-2-en-1-amine is CN(C)C/C=C/Br.
What is the InChIKey of (E)-3-bromo-N,N-dimethylprop-2-en-1-amine?
The InChIKey is IQUZWVSCEFCUJB-ONEGZZNKSA-N. The full InChI is InChI=1S/C5H10BrN/c1-7(2)5-3-4-6/h3-4H,5H2,1-2H3/b4-3+.
What are the key properties of (E)-3-bromo-N,N-dimethylprop-2-en-1-amine?
(E)-3-bromo-N,N-dimethylprop-2-en-1-amine has a molecular weight of 164.05 g/mol, XLogP of 1.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-bromo-N,N-dimethylprop-2-en-1-amine is sourced from PubChem (CID 23271071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).