C6H10N2O2 — CID 23271146
(5S,6S)-5,6-dimethyl-1,3-diazinane-2,4-dione (PubChem CID 23271146) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is (5S,6S)-5,6-dimethyl-1,3-diazinane-2,4-dione.
| Compound Name | (5S,6S)-5,6-dimethyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 23271146 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (5S,6S)-5,6-dimethyl-1,3-diazinane-2,4-dione |
| SMILES | C[C@@H]1NC(=O)NC(=O)[C@H]1C |
| InChI | InChI=1S/C6H10N2O2/c1-3-4(2)7-6(10)8-5(3)9/h3-4H,1-2H3,(H2,7,8,9,10)/t3-,4-/m0/s1 |
| InChIKey | XQYUQCJDPCWDSO-IMJSIDKUSA-N |
| XLogP | -0.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |