C7H9F8O3P — CID 23271363
5-dimethoxyphosphoryl-1,1,2,2,3,3,4,4-octafluoropentane (PubChem CID 23271363) has the molecular formula C7H9F8O3P and a molecular weight of 324.10 g/mol. Its IUPAC name is 5-dimethoxyphosphoryl-1,1,2,2,3,3,4,4-octafluoropentane.
| Compound Name | 5-dimethoxyphosphoryl-1,1,2,2,3,3,4,4-octafluoropentane |
|---|---|
| PubChem CID | 23271363 |
| Molecular Formula | C7H9F8O3P |
| Molecular Weight | 324.10 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 5-dimethoxyphosphoryl-1,1,2,2,3,3,4,4-octafluoropentane |
| SMILES | COP(=O)(CC(F)(F)C(F)(F)C(F)(F)C(F)F)OC |
| InChI | InChI=1S/C7H9F8O3P/c1-17-19(16,18-2)3-5(10,11)7(14,15)6(12,13)4(8)9/h4H,3H2,1-2H3 |
| InChIKey | XPIZPZRRDIKDSS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.10 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|