C9H8F6O4 — CID 23271434
ethyl (E)-4,4,4-trifluoro-2-methyl-3-(2,2,2-trifluoroacetyl)oxybut-2-enoate (PubChem CID 23271434) has the molecular formula C9H8F6O4 and a molecular weight of 294.15 g/mol. Its IUPAC name is ethyl (E)-4,4,4-trifluoro-2-methyl-3-(2,2,2-trifluoroacetyl)oxybut-2-enoate.
| Compound Name | ethyl (E)-4,4,4-trifluoro-2-methyl-3-(2,2,2-trifluoroacetyl)oxybut-2-enoate |
|---|---|
| PubChem CID | 23271434 |
| Molecular Formula | C9H8F6O4 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | ethyl (E)-4,4,4-trifluoro-2-methyl-3-(2,2,2-trifluoroacetyl)oxybut-2-enoate |
| SMILES | CCOC(=O)/C(C)=C(/OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8F6O4/c1-3-18-6(16)4(2)5(8(10,11)12)19-7(17)9(13,14)15/h3H2,1-2H3/b5-4+ |
| InChIKey | FMPSMPIEMJVKPF-SNAWJCMRSA-N |
| XLogP | 2.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|