C9H10N2S — CID 23271437
5-methyl-2-phenyl-2,3-dihydro-1,3,4-thiadiazole (PubChem CID 23271437) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 5-methyl-2-phenyl-2,3-dihydro-1,3,4-thiadiazole.
| Compound Name | 5-methyl-2-phenyl-2,3-dihydro-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 23271437 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 5-methyl-2-phenyl-2,3-dihydro-1,3,4-thiadiazole |
| SMILES | CC1=NNC(c2ccccc2)S1 |
| InChI | InChI=1S/C9H10N2S/c1-7-10-11-9(12-7)8-5-3-2-4-6-8/h2-6,9,11H,1H3 |
| InChIKey | QJTKRMSDYBJVFR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |