C14H7F7O2 — CID 23271593
[(1S,8S,9S)-3,4,5,6-tetrafluoro-9-tricyclo[6.3.1.02,7]dodeca-2(7),3,5,10-tetraenyl] 2,2,2-trifluoroacetate (PubChem CID 23271593) has the molecular formula C14H7F7O2 and a molecular weight of 340.19 g/mol. Its IUPAC name is [(1S,8S,9S)-3,4,5,6-tetrafluoro-9-tricyclo[6.3.1.02,7]dodeca-2(7),3,5,10-tetraenyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,8S,9S)-3,4,5,6-tetrafluoro-9-tricyclo[6.3.1.02,7]dodeca-2(7),3,5,10-tetraenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 23271593 |
| Molecular Formula | C14H7F7O2 |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | [(1S,8S,9S)-3,4,5,6-tetrafluoro-9-tricyclo[6.3.1.02,7]dodeca-2(7),3,5,10-tetraenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(O[C@H]1C=C[C@@H]2C[C@H]1c1c(F)c(F)c(F)c(F)c12)C(F)(F)F |
| InChI | InChI=1S/C14H7F7O2/c15-9-7-4-1-2-6(23-13(22)14(19,20)21)5(3-4)8(7)10(16)12(18)11(9)17/h1-2,4-6H,3H2/t4-,5-,6+/m1/s1 |
| InChIKey | OOWKJAKRALLXNG-PBXRRBTRSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|