C15H6F27N — CID 23271690
3,3,3-trifluoro-N,N-bis[3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]-2,2-bis(trifluoromethyl)propan-1-amine (PubChem CID 23271690) has the molecular formula C15H6F27N and a molecular weight of 713.17 g/mol. Its IUPAC name is 3,3,3-trifluoro-N,N-bis[3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]-2,2-bis(trifluoromethyl)propan-1-amine.
| Compound Name | 3,3,3-trifluoro-N,N-bis[3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]-2,2-bis(trifluoromethyl)propan-1-amine |
|---|---|
| PubChem CID | 23271690 |
| Molecular Formula | C15H6F27N |
| Molecular Weight | 713.17 g/mol |
| Exact Mass | 713.01 |
| IUPAC Name | 3,3,3-trifluoro-N,N-bis[3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]-2,2-bis(trifluoromethyl)propan-1-amine |
| SMILES | FC(F)(F)C(CN(CC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)CC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H6F27N/c16-7(17,18)4(8(19,20)21,9(22,23)24)1-43(2-5(10(25,26)27,11(28,29)30)12(31,32)33)3-6(13(34,35)36,14(37,38)39)15(40,41)42/h1-3H2 |
| InChIKey | VEYMAHSDQGAAGR-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.17 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |