C16H22O8 — CID 23271778
trimethyl 3a-hydroxy-3-methyl-5-oxo-1,2,3,4,6,7-hexahydroindene-1,2,7a-tricarboxylate (PubChem CID 23271778) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is trimethyl 3a-hydroxy-3-methyl-5-oxo-1,2,3,4,6,7-hexahydroindene-1,2,7a-tricarboxylate.
| Compound Name | trimethyl 3a-hydroxy-3-methyl-5-oxo-1,2,3,4,6,7-hexahydroindene-1,2,7a-tricarboxylate |
|---|---|
| PubChem CID | 23271778 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | trimethyl 3a-hydroxy-3-methyl-5-oxo-1,2,3,4,6,7-hexahydroindene-1,2,7a-tricarboxylate |
| SMILES | COC(=O)C1C(C)C2(O)CC(=O)CCC2(C(=O)OC)C1C(=O)OC |
| InChI | InChI=1S/C16H22O8/c1-8-10(12(18)22-2)11(13(19)23-3)15(14(20)24-4)6-5-9(17)7-16(8,15)21/h8,10-11,21H,5-7H2,1-4H3 |
| InChIKey | MOVIUSSFKNKBBU-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|