C18HF12N — CID 23271823
2-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetonitrile (PubChem CID 23271823) has the molecular formula C18HF12N and a molecular weight of 459.19 g/mol. Its IUPAC name is 2-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetonitrile.
| Compound Name | 2-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 23271823 |
| Molecular Formula | C18HF12N |
| Molecular Weight | 459.19 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | 2-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetonitrile |
| SMILES | N#CC(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C18HF12N/c19-7-3(2(1-31)4-9(21)14(26)18(30)15(27)10(4)22)8(20)11(23)6-5(7)12(24)16(28)17(29)13(6)25/h2H |
| InChIKey | RTXPMBCMHKMAPP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.19 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|