C19HBrF14 — CID 23271866
1-[bis(2,3,4,5,6-pentafluorophenyl)methyl]-4-bromo-2,3,5,6-tetrafluorobenzene (PubChem CID 23271866) has the molecular formula C19HBrF14 and a molecular weight of 575.09 g/mol. Its IUPAC name is 1-[bis(2,3,4,5,6-pentafluorophenyl)methyl]-4-bromo-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1-[bis(2,3,4,5,6-pentafluorophenyl)methyl]-4-bromo-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 23271866 |
| Molecular Formula | C19HBrF14 |
| Molecular Weight | 575.09 g/mol |
| Exact Mass | 573.90 |
| IUPAC Name | 1-[bis(2,3,4,5,6-pentafluorophenyl)methyl]-4-bromo-2,3,5,6-tetrafluorobenzene |
| SMILES | Fc1c(F)c(F)c(C(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(Br)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C19HBrF14/c20-5-12(27)6(21)2(7(22)13(5)28)1(3-8(23)14(29)18(33)15(30)9(3)24)4-10(25)16(31)19(34)17(32)11(4)26/h1H |
| InChIKey | PSTJPJZGYKULGF-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.09 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|