About 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate
2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate (PubChem CID 2327189) has the molecular formula C27H28N4O3S
and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate |
| PubChem CID | 2327189 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)c2cn(-c3ccccc3)nc2-c2cccs2)cc1 |
| InChI | InChI=1S/C27H28N4O3S/c1-3-30(4-2)16-17-34-27(33)20-12-14-21(15-13-20)28-26(32)23-19-31(22-9-6-5-7-10-22)29-25(23)24-11-8-18-35-24/h5-15,18-19H,3-4,16-17H2,1-2H3,(H,28,32) |
| InChIKey | XTAJNRYOMCJSHW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate?
The IUPAC name of 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate (CID 2327189) is 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate.
What is the SMILES notation for 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate?
The canonical SMILES for 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate is CCN(CC)CCOC(=O)c1ccc(NC(=O)c2cn(-c3ccccc3)nc2-c2cccs2)cc1.
What is the InChIKey of 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate?
The InChIKey is XTAJNRYOMCJSHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N4O3S/c1-3-30(4-2)16-17-34-27(33)20-12-14-21(15-13-20)28-26(32)23-19-31(22-9-6-5-7-10-22)29-25(23)24-11-8-18-35-24/h5-15,18-19H,3-4,16-17H2,1-2H3,(H,28,32).
What are the key properties of 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate?
2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate has a molecular weight of 488.61 g/mol, XLogP of 5.35, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]benzoate is sourced from PubChem (CID 2327189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).