C20H4F14 — CID 23271920
1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-methylphenyl)methyl]benzene (PubChem CID 23271920) has the molecular formula C20H4F14 and a molecular weight of 510.22 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-methylphenyl)methyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-methylphenyl)methyl]benzene |
|---|---|
| PubChem CID | 23271920 |
| Molecular Formula | C20H4F14 |
| Molecular Weight | 510.22 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluoro-4-methylphenyl)methyl]benzene |
| SMILES | Cc1c(F)c(F)c(C(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C20H4F14/c1-2-7(21)9(23)4(10(24)8(2)22)3(5-11(25)15(29)19(33)16(30)12(5)26)6-13(27)17(31)20(34)18(32)14(6)28/h3H,1H3 |
| InChIKey | XHUSLGUVUWEPDT-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.22 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|