C21H32O2S2 — CID 23271980
1-[(16S,17R)-3-hydroxy-10,13-dimethyl-16,17-bis(sulfanyl)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 23271980) has the molecular formula C21H32O2S2 and a molecular weight of 380.62 g/mol. Its IUPAC name is 1-[(16S,17R)-3-hydroxy-10,13-dimethyl-16,17-bis(sulfanyl)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(16S,17R)-3-hydroxy-10,13-dimethyl-16,17-bis(sulfanyl)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 23271980 |
| Molecular Formula | C21H32O2S2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-[(16S,17R)-3-hydroxy-10,13-dimethyl-16,17-bis(sulfanyl)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@@]1(S)[C@@H](S)CC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C21H32O2S2/c1-12(22)21(25)18(24)11-17-15-5-4-13-10-14(23)6-8-19(13,2)16(15)7-9-20(17,21)3/h4,14-18,23-25H,5-11H2,1-3H3/t14?,15?,16?,17?,18-,19?,20?,21+/m0/s1 |
| InChIKey | CCXDHCSKDPLOLR-VJURLDOLSA-N |
| XLogP | 4.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|