C28H40O6 — CID 23272079
[(3Z)-3-[(3S,10R,13S,16S)-3,16-diacetyloxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]propyl] acetate (PubChem CID 23272079) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is [(3Z)-3-[(3S,10R,13S,16S)-3,16-diacetyloxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]propyl] acetate.
| Compound Name | [(3Z)-3-[(3S,10R,13S,16S)-3,16-diacetyloxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]propyl] acetate |
|---|---|
| PubChem CID | 23272079 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | [(3Z)-3-[(3S,10R,13S,16S)-3,16-diacetyloxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]propyl] acetate |
| SMILES | CC(=O)OCC/C=C1\[C@@H](OC(C)=O)CC2C3CC=C4C[C@@H](OC(C)=O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C28H40O6/c1-17(29)32-14-6-7-24-26(34-19(3)31)16-25-22-9-8-20-15-21(33-18(2)30)10-12-27(20,4)23(22)11-13-28(24,25)5/h7-8,21-23,25-26H,6,9-16H2,1-5H3/b24-7+/t21-,22?,23?,25?,26-,27-,28+/m0/s1 |
| InChIKey | JGSFPNQVJQGDSA-ATHCXTGJSA-N |
| XLogP | 5.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|