About 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one
1-(5-amino-1,2,4-triazol-1-yl)propan-1-one (PubChem CID 23272117) has the molecular formula C5H8N4O
and a molecular weight of 140.15 g/mol. Its IUPAC name is 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one |
| PubChem CID | 23272117 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one |
| SMILES | CCC(=O)n1ncnc1N |
| InChI | InChI=1S/C5H8N4O/c1-2-4(10)9-5(6)7-3-8-9/h3H,2H2,1H3,(H2,6,7,8) |
| InChIKey | LDRRKZUDAODKQR-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one?
The IUPAC name of 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one (CID 23272117) is 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one.
What is the SMILES notation for 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one?
The canonical SMILES for 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one is CCC(=O)n1ncnc1N.
What is the InChIKey of 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one?
The InChIKey is LDRRKZUDAODKQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O/c1-2-4(10)9-5(6)7-3-8-9/h3H,2H2,1H3,(H2,6,7,8).
What are the key properties of 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one?
1-(5-amino-1,2,4-triazol-1-yl)propan-1-one has a molecular weight of 140.15 g/mol, XLogP of -0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-1,2,4-triazol-1-yl)propan-1-one is sourced from PubChem (CID 23272117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).