About (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide
(2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide (PubChem CID 23272153) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide |
| PubChem CID | 23272153 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide |
| SMILES | CON1C[C@H]1C(=O)N(C)C |
| InChI | InChI=1S/C6H12N2O2/c1-7(2)6(9)5-4-8(5)10-3/h5H,4H2,1-3H3/t5-,8?/m0/s1 |
| InChIKey | DNNSFBVRFNUOOD-NTFOPCPOSA-N |
| XLogP | -0.68 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide?
The IUPAC name of (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide (CID 23272153) is (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide.
What is the SMILES notation for (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide?
The canonical SMILES for (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide is CON1C[C@H]1C(=O)N(C)C.
What is the InChIKey of (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide?
The InChIKey is DNNSFBVRFNUOOD-NTFOPCPOSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-7(2)6(9)5-4-8(5)10-3/h5H,4H2,1-3H3/t5-,8?/m0/s1.
What are the key properties of (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide?
(2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide has a molecular weight of 144.17 g/mol, XLogP of -0.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-methoxy-N,N-dimethylaziridine-2-carboxamide is sourced from PubChem (CID 23272153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).