C14H10Br2O5 — CID 23272619
(1S,2S,6R,7S,8R,9S)-8,9-dibromo-1-phenoxy-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 23272619) has the molecular formula C14H10Br2O5 and a molecular weight of 418.04 g/mol. Its IUPAC name is (1S,2S,6R,7S,8R,9S)-8,9-dibromo-1-phenoxy-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2S,6R,7S,8R,9S)-8,9-dibromo-1-phenoxy-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 23272619 |
| Molecular Formula | C14H10Br2O5 |
| Molecular Weight | 418.04 g/mol |
| Exact Mass | 415.89 |
| IUPAC Name | (1S,2S,6R,7S,8R,9S)-8,9-dibromo-1-phenoxy-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1OC(=O)[C@H]2[C@@H]1[C@@H]1O[C@@]2(Oc2ccccc2)[C@H](Br)[C@@H]1Br |
| InChI | InChI=1S/C14H10Br2O5/c15-9-10-7-8(13(18)19-12(7)17)14(21-10,11(9)16)20-6-4-2-1-3-5-6/h1-5,7-11H/t7-,8-,9-,10+,11-,14-/m1/s1 |
| InChIKey | SWZBJHHOQCRILV-SCYIPDLESA-N |
| XLogP | 2.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.04 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|