About CID 23272700
CID 23272700 (PubChem CID 23272700) has the molecular formula C7H18O4PS+
and a molecular weight of 229.26 g/mol.
Molecular Properties
| Compound Name | CID 23272700 |
| PubChem CID | 23272700 |
| Molecular Formula | C7H18O4PS+ |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | — |
| SMILES | CCOP(=O)(C[S+](C)(C)=O)OCC |
| InChI | InChI=1S/C7H18O4PS/c1-5-10-12(8,11-6-2)7-13(3,4)9/h5-7H2,1-4H3/q+1 |
| InChIKey | PLFPUDNOTQCKIQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 23272700 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23272700?
The IUPAC name of CID 23272700 (CID 23272700) is not available.
What is the SMILES notation for CID 23272700?
The canonical SMILES for CID 23272700 is CCOP(=O)(C[S+](C)(C)=O)OCC.
What is the InChIKey of CID 23272700?
The InChIKey is PLFPUDNOTQCKIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18O4PS/c1-5-10-12(8,11-6-2)7-13(3,4)9/h5-7H2,1-4H3/q+1.
What are the key properties of CID 23272700?
CID 23272700 has a molecular weight of 229.26 g/mol, XLogP of 1.97, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23272700 is sourced from PubChem (CID 23272700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).