C8H3Cl2F5 — CID 23272706
1-(1,1-dichloroethyl)-2,3,4,5,6-pentafluorobenzene (PubChem CID 23272706) has the molecular formula C8H3Cl2F5 and a molecular weight of 265.01 g/mol. Its IUPAC name is 1-(1,1-dichloroethyl)-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(1,1-dichloroethyl)-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 23272706 |
| Molecular Formula | C8H3Cl2F5 |
| Molecular Weight | 265.01 g/mol |
| Exact Mass | 263.95 |
| IUPAC Name | 1-(1,1-dichloroethyl)-2,3,4,5,6-pentafluorobenzene |
| SMILES | CC(Cl)(Cl)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H3Cl2F5/c1-8(9,10)2-3(11)5(13)7(15)6(14)4(2)12/h1H3 |
| InChIKey | PQDRBUCIEUCYNY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.01 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|