C8H10F9NS — CID 23272735
N-ethyl-N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfanylethanamine (PubChem CID 23272735) has the molecular formula C8H10F9NS and a molecular weight of 323.22 g/mol. Its IUPAC name is N-ethyl-N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfanylethanamine.
| Compound Name | N-ethyl-N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfanylethanamine |
|---|---|
| PubChem CID | 23272735 |
| Molecular Formula | C8H10F9NS |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | N-ethyl-N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfanylethanamine |
| SMILES | CCN(CC)SC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10F9NS/c1-3-18(4-2)19-5(6(9,10)11,7(12,13)14)8(15,16)17/h3-4H2,1-2H3 |
| InChIKey | QMLHRTVFNQLDKB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|