C8H10N8O4 — CID 23272736
6-[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]ethylamino]-2H-1,2,4-triazine-3,5-dione (PubChem CID 23272736) has the molecular formula C8H10N8O4 and a molecular weight of 282.22 g/mol. Its IUPAC name is 6-[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]ethylamino]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]ethylamino]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 23272736 |
| Molecular Formula | C8H10N8O4 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 6-[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]ethylamino]-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NCCNc2n[nH]c(=O)[nH]c2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C8H10N8O4/c17-5-3(13-15-7(19)11-5)9-1-2-10-4-6(18)12-8(20)16-14-4/h1-2H2,(H,9,13)(H,10,14)(H2,11,15,17,19)(H2,12,16,18,20) |
| InChIKey | MBNZNCSMZJNTNG-UHFFFAOYSA-N |
| XLogP | -3.25 |
| TPSA | 181.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|