C8H13O3P — CID 23272765
2-(cyclohexen-1-yloxy)-1,3,2-dioxaphospholane (PubChem CID 23272765) has the molecular formula C8H13O3P and a molecular weight of 188.16 g/mol. Its IUPAC name is 2-(cyclohexen-1-yloxy)-1,3,2-dioxaphospholane.
| Compound Name | 2-(cyclohexen-1-yloxy)-1,3,2-dioxaphospholane |
|---|---|
| PubChem CID | 23272765 |
| Molecular Formula | C8H13O3P |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2-(cyclohexen-1-yloxy)-1,3,2-dioxaphospholane |
| SMILES | C1=C(OP2OCCO2)CCCC1 |
| InChI | InChI=1S/C8H13O3P/c1-2-4-8(5-3-1)11-12-9-6-7-10-12/h4H,1-3,5-7H2 |
| InChIKey | XLRYDLBFYFZPTQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|