C9H9F3O3 — CID 23272814
(3Z)-6-methyl-3-(2,2,2-trifluoro-1-hydroxyethylidene)-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 23272814) has the molecular formula C9H9F3O3 and a molecular weight of 222.16 g/mol. Its IUPAC name is (3Z)-6-methyl-3-(2,2,2-trifluoro-1-hydroxyethylidene)-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (3Z)-6-methyl-3-(2,2,2-trifluoro-1-hydroxyethylidene)-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 23272814 |
| Molecular Formula | C9H9F3O3 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | (3Z)-6-methyl-3-(2,2,2-trifluoro-1-hydroxyethylidene)-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | CC12CC/C(=C(/O)C(F)(F)F)C(=O)C1O2 |
| InChI | InChI=1S/C9H9F3O3/c1-8-3-2-4(5(13)7(8)15-8)6(14)9(10,11)12/h7,14H,2-3H2,1H3/b6-4- |
| InChIKey | UNEZJKMMJCJRJM-XQRVVYSFSA-N |
| XLogP | 1.88 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|