C10H2F20O4 — CID 23272905
1,1,1,2,4,5,5,5-octafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]-4-(trifluoromethoxy)pentan-3-ol (PubChem CID 23272905) has the molecular formula C10H2F20O4 and a molecular weight of 566.08 g/mol. Its IUPAC name is 1,1,1,2,4,5,5,5-octafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]-4-(trifluoromethoxy)pentan-3-ol.
| Compound Name | 1,1,1,2,4,5,5,5-octafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]-4-(trifluoromethoxy)pentan-3-ol |
|---|---|
| PubChem CID | 23272905 |
| Molecular Formula | C10H2F20O4 |
| Molecular Weight | 566.08 g/mol |
| Exact Mass | 565.96 |
| IUPAC Name | 1,1,1,2,4,5,5,5-octafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]-4-(trifluoromethoxy)pentan-3-ol |
| SMILES | OC(C(F)(OC(F)(F)F)C(F)(F)F)C(F)(OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H2F20O4/c11-2(5(15,16)17,1(31)3(12,6(18,19)20)33-9(25,26)27)32-7(21,22)4(13,14)8(23,24)34-10(28,29)30/h1,31H |
| InChIKey | MWISNHSPGAYKFW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.08 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|