C12H18Cl2 — CID 23273214
(1R,3R,5S,7S)-8,8-dichloro-1,4,4,7-tetramethyltricyclo[5.1.0.03,5]octane (PubChem CID 23273214) has the molecular formula C12H18Cl2 and a molecular weight of 233.18 g/mol. Its IUPAC name is (1R,3R,5S,7S)-8,8-dichloro-1,4,4,7-tetramethyltricyclo[5.1.0.03,5]octane.
| Compound Name | (1R,3R,5S,7S)-8,8-dichloro-1,4,4,7-tetramethyltricyclo[5.1.0.03,5]octane |
|---|---|
| PubChem CID | 23273214 |
| Molecular Formula | C12H18Cl2 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (1R,3R,5S,7S)-8,8-dichloro-1,4,4,7-tetramethyltricyclo[5.1.0.03,5]octane |
| SMILES | CC1(C)[C@@H]2C[C@@]3(C)C(Cl)(Cl)[C@@]3(C)C[C@@H]21 |
| InChI | InChI=1S/C12H18Cl2/c1-9(2)7-5-10(3)11(4,6-8(7)9)12(10,13)14/h7-8H,5-6H2,1-4H3/t7-,8+,10-,11+ |
| InChIKey | QVRPXYYZIUSWFV-CBZSFBHOSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|