About 2-acetamidobutanediamide
2-acetamidobutanediamide (PubChem CID 23273577) has the molecular formula C6H11N3O3
and a molecular weight of 173.17 g/mol. Its IUPAC name is 2-acetamidobutanediamide.
Molecular Properties
| Compound Name | 2-acetamidobutanediamide |
| PubChem CID | 23273577 |
| Molecular Formula | C6H11N3O3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 2-acetamidobutanediamide |
| SMILES | CC(=O)NC(CC(N)=O)C(N)=O |
| InChI | InChI=1S/C6H11N3O3/c1-3(10)9-4(6(8)12)2-5(7)11/h4H,2H2,1H3,(H2,7,11)(H2,8,12)(H,9,10) |
| InChIKey | OANWRLMVAWRMEK-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-acetamidobutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidobutanediamide?
The IUPAC name of 2-acetamidobutanediamide (CID 23273577) is 2-acetamidobutanediamide.
What is the SMILES notation for 2-acetamidobutanediamide?
The canonical SMILES for 2-acetamidobutanediamide is CC(=O)NC(CC(N)=O)C(N)=O.
What is the InChIKey of 2-acetamidobutanediamide?
The InChIKey is OANWRLMVAWRMEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O3/c1-3(10)9-4(6(8)12)2-5(7)11/h4H,2H2,1H3,(H2,7,11)(H2,8,12)(H,9,10).
What are the key properties of 2-acetamidobutanediamide?
2-acetamidobutanediamide has a molecular weight of 173.17 g/mol, XLogP of -2.15, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidobutanediamide is sourced from PubChem (CID 23273577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).