C7H8N2O4 — CID 23273709
1-propyl-1,3-diazinane-2,4,5,6-tetrone (PubChem CID 23273709) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is 1-propyl-1,3-diazinane-2,4,5,6-tetrone.
| Compound Name | 1-propyl-1,3-diazinane-2,4,5,6-tetrone |
|---|---|
| PubChem CID | 23273709 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 1-propyl-1,3-diazinane-2,4,5,6-tetrone |
| SMILES | CCCN1C(=O)NC(=O)C(=O)C1=O |
| InChI | InChI=1S/C7H8N2O4/c1-2-3-9-6(12)4(10)5(11)8-7(9)13/h2-3H2,1H3,(H,8,11,13) |
| InChIKey | VEFBEPVAYHPEIX-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|