About 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline
3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline (PubChem CID 23273824) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline.
Molecular Properties
| Compound Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline |
| PubChem CID | 23273824 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline |
| SMILES | CN1CC=C(c2cccc(N)c2)CC1 |
| InChI | InChI=1S/C12H16N2/c1-14-7-5-10(6-8-14)11-3-2-4-12(13)9-11/h2-5,9H,6-8,13H2,1H3 |
| InChIKey | XXFOMXBPZIXRAX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline?
The IUPAC name of 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline (CID 23273824) is 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline.
What is the SMILES notation for 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline?
The canonical SMILES for 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline is CN1CC=C(c2cccc(N)c2)CC1.
What is the InChIKey of 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline?
The InChIKey is XXFOMXBPZIXRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-14-7-5-10(6-8-14)11-3-2-4-12(13)9-11/h2-5,9H,6-8,13H2,1H3.
What are the key properties of 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline?
3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline has a molecular weight of 188.27 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)aniline is sourced from PubChem (CID 23273824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).