About N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide
N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 23273856) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| PubChem CID | 23273856 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | O=C(NC1CCCC1)N1CC=CCC1 |
| InChI | InChI=1S/C11H18N2O/c14-11(12-10-6-2-3-7-10)13-8-4-1-5-9-13/h1,4,10H,2-3,5-9H2,(H,12,14) |
| InChIKey | HFTVFWXMSOSVOG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide?
The IUPAC name of N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide (CID 23273856) is N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide.
What is the SMILES notation for N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide?
The canonical SMILES for N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide is O=C(NC1CCCC1)N1CC=CCC1.
What is the InChIKey of N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide?
The InChIKey is HFTVFWXMSOSVOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c14-11(12-10-6-2-3-7-10)13-8-4-1-5-9-13/h1,4,10H,2-3,5-9H2,(H,12,14).
What are the key properties of N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide?
N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide has a molecular weight of 194.28 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-3,6-dihydro-2H-pyridine-1-carboxamide is sourced from PubChem (CID 23273856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).