C6H7F7N2S — CID 23274434
1-(2,2,3,3,4,4,4-heptafluorobutyl)-3-methylthiourea (PubChem CID 23274434) has the molecular formula C6H7F7N2S and a molecular weight of 272.19 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,4-heptafluorobutyl)-3-methylthiourea.
| Compound Name | 1-(2,2,3,3,4,4,4-heptafluorobutyl)-3-methylthiourea |
|---|---|
| PubChem CID | 23274434 |
| Molecular Formula | C6H7F7N2S |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 1-(2,2,3,3,4,4,4-heptafluorobutyl)-3-methylthiourea |
| SMILES | CNC(=S)NCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H7F7N2S/c1-14-3(16)15-2-4(7,8)5(9,10)6(11,12)13/h2H2,1H3,(H2,14,15,16) |
| InChIKey | VCBWYBOKEVUWDU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|