About 4,4-diphenyl-1,4-azasilinane
4,4-diphenyl-1,4-azasilinane (PubChem CID 23274849) has the molecular formula C16H19NSi
and a molecular weight of 253.42 g/mol. Its IUPAC name is 4,4-diphenyl-1,4-azasilinane.
Molecular Properties
| Compound Name | 4,4-diphenyl-1,4-azasilinane |
| PubChem CID | 23274849 |
| Molecular Formula | C16H19NSi |
| Molecular Weight | 253.42 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4,4-diphenyl-1,4-azasilinane |
| SMILES | c1ccc([Si]2(c3ccccc3)CCNCC2)cc1 |
| InChI | InChI=1S/C16H19NSi/c1-3-7-15(8-4-1)18(13-11-17-12-14-18)16-9-5-2-6-10-16/h1-10,17H,11-14H2 |
| InChIKey | USMARMWJTDPVLT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diphenyl-1,4-azasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diphenyl-1,4-azasilinane?
The IUPAC name of 4,4-diphenyl-1,4-azasilinane (CID 23274849) is 4,4-diphenyl-1,4-azasilinane.
What is the SMILES notation for 4,4-diphenyl-1,4-azasilinane?
The canonical SMILES for 4,4-diphenyl-1,4-azasilinane is c1ccc([Si]2(c3ccccc3)CCNCC2)cc1.
What is the InChIKey of 4,4-diphenyl-1,4-azasilinane?
The InChIKey is USMARMWJTDPVLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NSi/c1-3-7-15(8-4-1)18(13-11-17-12-14-18)16-9-5-2-6-10-16/h1-10,17H,11-14H2.
What are the key properties of 4,4-diphenyl-1,4-azasilinane?
4,4-diphenyl-1,4-azasilinane has a molecular weight of 253.42 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diphenyl-1,4-azasilinane is sourced from PubChem (CID 23274849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).