C8H11F2N5O3S — CID 23275246
2,2-difluoro-N-(2-methylsulfanylethyl)-3-(3-nitro-1,2,4-triazol-1-yl)propanamide (PubChem CID 23275246) has the molecular formula C8H11F2N5O3S and a molecular weight of 295.27 g/mol. Its IUPAC name is 2,2-difluoro-N-(2-methylsulfanylethyl)-3-(3-nitro-1,2,4-triazol-1-yl)propanamide.
| Compound Name | 2,2-difluoro-N-(2-methylsulfanylethyl)-3-(3-nitro-1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 23275246 |
| Molecular Formula | C8H11F2N5O3S |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2,2-difluoro-N-(2-methylsulfanylethyl)-3-(3-nitro-1,2,4-triazol-1-yl)propanamide |
| SMILES | CSCCNC(=O)C(F)(F)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C8H11F2N5O3S/c1-19-3-2-11-6(16)8(9,10)4-14-5-12-7(13-14)15(17)18/h5H,2-4H2,1H3,(H,11,16) |
| InChIKey | UXASZKHDEXAUES-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|