C17H16N2O — CID 23275338
7,9-dimethyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 23275338) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 7,9-dimethyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 7,9-dimethyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 23275338 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 7,9-dimethyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | Cc1cc(C)c2c(c1)C(c1ccccc1)=NCC(=O)N2 |
| InChI | InChI=1S/C17H16N2O/c1-11-8-12(2)16-14(9-11)17(18-10-15(20)19-16)13-6-4-3-5-7-13/h3-9H,10H2,1-2H3,(H,19,20) |
| InChIKey | ZMXLAUDJKIBNLG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |