About N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide
N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide (PubChem CID 23275486) has the molecular formula C11H12F2N2O5
and a molecular weight of 290.22 g/mol. Its IUPAC name is N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide |
| PubChem CID | 23275486 |
| Molecular Formula | C11H12F2N2O5 |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide |
| SMILES | O=C(NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)C(F)F |
| InChI | InChI=1S/C11H12F2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18) |
| InChIKey | FNEJBMHYUJWQSX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide?
The IUPAC name of N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide (CID 23275486) is N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide.
What is the SMILES notation for N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide?
The canonical SMILES for N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide is O=C(NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)C(F)F.
What is the InChIKey of N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide?
The InChIKey is FNEJBMHYUJWQSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18).
What are the key properties of N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide?
N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide has a molecular weight of 290.22 g/mol, XLogP of 0.37, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-2,2-difluoroacetamide is sourced from PubChem (CID 23275486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).