C9H13F2N5O3S — CID 23275548
2,2-difluoro-N-(3-methylsulfanylpropyl)-3-(3-nitro-1,2,4-triazol-1-yl)propanamide (PubChem CID 23275548) has the molecular formula C9H13F2N5O3S and a molecular weight of 309.30 g/mol. Its IUPAC name is 2,2-difluoro-N-(3-methylsulfanylpropyl)-3-(3-nitro-1,2,4-triazol-1-yl)propanamide.
| Compound Name | 2,2-difluoro-N-(3-methylsulfanylpropyl)-3-(3-nitro-1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 23275548 |
| Molecular Formula | C9H13F2N5O3S |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2,2-difluoro-N-(3-methylsulfanylpropyl)-3-(3-nitro-1,2,4-triazol-1-yl)propanamide |
| SMILES | CSCCCNC(=O)C(F)(F)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H13F2N5O3S/c1-20-4-2-3-12-7(17)9(10,11)5-15-6-13-8(14-15)16(18)19/h6H,2-5H2,1H3,(H,12,17) |
| InChIKey | RYMFKOCLELLXBJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|