C19H29N3O5 — CID 23276902
2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-methylpentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 23276902) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-methylpentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-methylpentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 23276902 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-methylpentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)Cc1ccccc1)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C19H29N3O5/c1-4-11(2)15(18(25)22-16(12(3)23)19(26)27)21-17(24)14(20)10-13-8-6-5-7-9-13/h5-9,11-12,14-16,23H,4,10,20H2,1-3H3,(H,21,24)(H,22,25)(H,26,27) |
| InChIKey | BYAIIACBWBOJCU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |