C45H58N4O5 — CID 23277720
4-[[(E)-6-acetamido-2-[[3-naphthalen-2-yl-2-(naphthalen-1-ylmethyl)propanoyl]amino]hex-4-enoyl]amino]-3-hydroxy-6-methyl-N-(2-methylbutyl)heptanamide (PubChem CID 23277720) has the molecular formula C45H58N4O5 and a molecular weight of 734.98 g/mol. Its IUPAC name is 4-[[(E)-6-acetamido-2-[[3-naphthalen-2-yl-2-(naphthalen-1-ylmethyl)propanoyl]amino]hex-4-enoyl]amino]-3-hydroxy-6-methyl-N-(2-methylbutyl)heptanamide.
| Compound Name | 4-[[(E)-6-acetamido-2-[[3-naphthalen-2-yl-2-(naphthalen-1-ylmethyl)propanoyl]amino]hex-4-enoyl]amino]-3-hydroxy-6-methyl-N-(2-methylbutyl)heptanamide |
|---|---|
| PubChem CID | 23277720 |
| Molecular Formula | C45H58N4O5 |
| Molecular Weight | 734.98 g/mol |
| Exact Mass | 734.44 |
| IUPAC Name | 4-[[(E)-6-acetamido-2-[[3-naphthalen-2-yl-2-(naphthalen-1-ylmethyl)propanoyl]amino]hex-4-enoyl]amino]-3-hydroxy-6-methyl-N-(2-methylbutyl)heptanamide |
| SMILES | CCC(C)CNC(=O)CC(O)C(CC(C)C)NC(=O)C(C/C=C/CNC(C)=O)NC(=O)C(Cc1ccc2ccccc2c1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C45H58N4O5/c1-6-31(4)29-47-43(52)28-42(51)41(24-30(2)3)49-45(54)40(20-11-12-23-46-32(5)50)48-44(53)38(26-33-21-22-34-14-7-8-16-36(34)25-33)27-37-18-13-17-35-15-9-10-19-39(35)37/h7-19,21-22,25,30-31,38,40-42,51H,6,20,23-24,26-29H2,1-5H3,(H,46,50)(H,47,52)(H,48,53)(H,49,54)/b12-11+ |
| InChIKey | YOMYUTLWJFTNRK-VAWYXSNFSA-N |
| XLogP | 6.41 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.98 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|