About (2-bromophenyl)azanium
(2-bromophenyl)azanium (PubChem CID 23277840) has the molecular formula C6H7BrN+
and a molecular weight of 173.03 g/mol. Its IUPAC name is (2-bromophenyl)azanium.
Molecular Properties
| Compound Name | (2-bromophenyl)azanium |
| PubChem CID | 23277840 |
| Molecular Formula | C6H7BrN+ |
| Molecular Weight | 173.03 g/mol |
| Exact Mass | 171.98 |
| IUPAC Name | (2-bromophenyl)azanium |
| SMILES | [NH3+]c1ccccc1Br |
| InChI | InChI=1S/C6H6BrN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2/p+1 |
| InChIKey | AOPBDRUWRLBSDB-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.03 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2-bromophenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)azanium?
The IUPAC name of (2-bromophenyl)azanium (CID 23277840) is (2-bromophenyl)azanium.
What is the SMILES notation for (2-bromophenyl)azanium?
The canonical SMILES for (2-bromophenyl)azanium is [NH3+]c1ccccc1Br.
What is the InChIKey of (2-bromophenyl)azanium?
The InChIKey is AOPBDRUWRLBSDB-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H6BrN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2/p+1.
What are the key properties of (2-bromophenyl)azanium?
(2-bromophenyl)azanium has a molecular weight of 173.03 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)azanium is sourced from PubChem (CID 23277840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).