C25H25N5OS — CID 2327787
(E)-N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enamide (PubChem CID 2327787) has the molecular formula C25H25N5OS and a molecular weight of 443.58 g/mol. Its IUPAC name is (E)-N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 2327787 |
| Molecular Formula | C25H25N5OS |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (E)-N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enamide |
| SMILES | CN(C)c1ccc(/C=C(\C#N)C(=O)Nc2nc3c(s2)CCN(Cc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C25H25N5OS/c1-29(2)21-10-8-18(9-11-21)14-20(15-26)24(31)28-25-27-22-17-30(13-12-23(22)32-25)16-19-6-4-3-5-7-19/h3-11,14H,12-13,16-17H2,1-2H3,(H,27,28,31)/b20-14+ |
| InChIKey | YKDHYRFEHZLYRU-XSFVSMFZSA-N |
| XLogP | 4.31 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|