C10H19N — CID 23277875
(4aS,8aS)-1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 23277875) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (4aS,8aS)-1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4aS,8aS)-1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 23277875 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (4aS,8aS)-1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | CN1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C10H19N/c1-11-8-4-6-9-5-2-3-7-10(9)11/h9-10H,2-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | AAARTTJTRNAYHQ-UWVGGRQHSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |