About 1-propan-2-ylaziridine
1-propan-2-ylaziridine (PubChem CID 23277877) has the molecular formula C5H11N
and a molecular weight of 85.15 g/mol. Its IUPAC name is 1-propan-2-ylaziridine.
Molecular Properties
| Compound Name | 1-propan-2-ylaziridine |
| PubChem CID | 23277877 |
| Molecular Formula | C5H11N |
| Molecular Weight | 85.15 g/mol |
| Exact Mass | 85.09 |
| IUPAC Name | 1-propan-2-ylaziridine |
| SMILES | CC(C)N1CC1 |
| InChI | InChI=1S/C5H11N/c1-5(2)6-3-4-6/h5H,3-4H2,1-2H3 |
| InChIKey | MMMPMWQSPXSMAH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.15 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-ylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-ylaziridine?
The IUPAC name of 1-propan-2-ylaziridine (CID 23277877) is 1-propan-2-ylaziridine.
What is the SMILES notation for 1-propan-2-ylaziridine?
The canonical SMILES for 1-propan-2-ylaziridine is CC(C)N1CC1.
What is the InChIKey of 1-propan-2-ylaziridine?
The InChIKey is MMMPMWQSPXSMAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N/c1-5(2)6-3-4-6/h5H,3-4H2,1-2H3.
What are the key properties of 1-propan-2-ylaziridine?
1-propan-2-ylaziridine has a molecular weight of 85.15 g/mol, XLogP of 0.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-ylaziridine is sourced from PubChem (CID 23277877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).