C10H16N3P — CID 23277914
1,3-dimethyl-N-phenyl-1,3,2-diazaphospholidin-2-amine (PubChem CID 23277914) has the molecular formula C10H16N3P and a molecular weight of 209.23 g/mol. Its IUPAC name is 1,3-dimethyl-N-phenyl-1,3,2-diazaphospholidin-2-amine.
| Compound Name | 1,3-dimethyl-N-phenyl-1,3,2-diazaphospholidin-2-amine |
|---|---|
| PubChem CID | 23277914 |
| Molecular Formula | C10H16N3P |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1,3-dimethyl-N-phenyl-1,3,2-diazaphospholidin-2-amine |
| SMILES | CN1CCN(C)P1Nc1ccccc1 |
| InChI | InChI=1S/C10H16N3P/c1-12-8-9-13(2)14(12)11-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | NOZYEDRCJANJKC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|