About ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate
ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate (PubChem CID 23278174) has the molecular formula C10H15F3N2O4
and a molecular weight of 284.23 g/mol. Its IUPAC name is ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate |
| PubChem CID | 23278174 |
| Molecular Formula | C10H15F3N2O4 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)C(C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O4/c1-4-19-8(17)6(3)14-7(16)5(2)15-9(18)10(11,12)13/h5-6H,4H2,1-3H3,(H,14,16)(H,15,18) |
| InChIKey | MZICDURUWQCPOC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate?
The IUPAC name of ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate (CID 23278174) is ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate.
What is the SMILES notation for ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate?
The canonical SMILES for ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate is CCOC(=O)C(C)NC(=O)C(C)NC(=O)C(F)(F)F.
What is the InChIKey of ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate?
The InChIKey is MZICDURUWQCPOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3N2O4/c1-4-19-8(17)6(3)14-7(16)5(2)15-9(18)10(11,12)13/h5-6H,4H2,1-3H3,(H,14,16)(H,15,18).
What are the key properties of ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate?
ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate has a molecular weight of 284.23 g/mol, XLogP of 0.12, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-[(2,2,2-trifluoroacetyl)amino]propanoylamino]propanoate is sourced from PubChem (CID 23278174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).