C24H20F3N4OS+ — CID 2327851
(E)-N-(5-benzyl-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-5-ium-2-yl)-2-cyano-3-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 2327851) has the molecular formula C24H20F3N4OS+ and a molecular weight of 469.51 g/mol. Its IUPAC name is (E)-N-(5-benzyl-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-5-ium-2-yl)-2-cyano-3-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(5-benzyl-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-5-ium-2-yl)-2-cyano-3-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 2327851 |
| Molecular Formula | C24H20F3N4OS+ |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | (E)-N-(5-benzyl-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-5-ium-2-yl)-2-cyano-3-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccccc1C(F)(F)F)C(=O)Nc1nc2c(s1)CC[NH+](Cc1ccccc1)C2 |
| InChI | InChI=1S/C24H19F3N4OS/c25-24(26,27)19-9-5-4-8-17(19)12-18(13-28)22(32)30-23-29-20-15-31(11-10-21(20)33-23)14-16-6-2-1-3-7-16/h1-9,12H,10-11,14-15H2,(H,29,30,32)/p+1/b18-12+ |
| InChIKey | DQZMDEUHGYVGCF-LDADJPATSA-O |
| XLogP | 3.85 |
| TPSA | 70.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|