C20H30N2O2Si — CID 23278623
2-[2-(dimethylamino)ethoxy-diphenylsilyl]oxy-N,N-dimethylethanamine (PubChem CID 23278623) has the molecular formula C20H30N2O2Si and a molecular weight of 358.56 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy-diphenylsilyl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[2-(dimethylamino)ethoxy-diphenylsilyl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 23278623 |
| Molecular Formula | C20H30N2O2Si |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy-diphenylsilyl]oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCO[Si](OCCN(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H30N2O2Si/c1-21(2)15-17-23-25(24-18-16-22(3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14H,15-18H2,1-4H3 |
| InChIKey | WDHCHYOPVXLTPV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|