C15H23N3O2 — CID 23278762
(6S,9R)-3-ethyl-N,N,2,6-tetramethyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-9-carboxamide (PubChem CID 23278762) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (6S,9R)-3-ethyl-N,N,2,6-tetramethyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-9-carboxamide.
| Compound Name | (6S,9R)-3-ethyl-N,N,2,6-tetramethyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-9-carboxamide |
|---|---|
| PubChem CID | 23278762 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (6S,9R)-3-ethyl-N,N,2,6-tetramethyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-9-carboxamide |
| SMILES | CCc1c(C)nc2n(c1=O)[C@@H](C)CC[C@H]2C(=O)N(C)C |
| InChI | InChI=1S/C15H23N3O2/c1-6-11-10(3)16-13-12(14(19)17(4)5)8-7-9(2)18(13)15(11)20/h9,12H,6-8H2,1-5H3/t9-,12+/m0/s1 |
| InChIKey | FWNIAAIBJHICGW-JOYOIKCWSA-N |
| XLogP | 1.64 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |