About 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium
7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium (PubChem CID 23278995) has the molecular formula C11H19N2+
and a molecular weight of 179.29 g/mol. Its IUPAC name is 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium.
Molecular Properties
| Compound Name | 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium |
| PubChem CID | 23278995 |
| Molecular Formula | C11H19N2+ |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium |
| SMILES | CN(C)C=CC=CC=CC=[N+](C)C |
| InChI | InChI=1S/C11H19N2/c1-12(2)10-8-6-5-7-9-11-13(3)4/h5-11H,1-4H3/q+1 |
| InChIKey | YEFWSFBHAKUJHV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium?
The IUPAC name of 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium (CID 23278995) is 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium.
What is the SMILES notation for 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium?
The canonical SMILES for 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium is CN(C)C=CC=CC=CC=[N+](C)C.
What is the InChIKey of 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium?
The InChIKey is YEFWSFBHAKUJHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N2/c1-12(2)10-8-6-5-7-9-11-13(3)4/h5-11H,1-4H3/q+1.
What are the key properties of 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium?
7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium has a molecular weight of 179.29 g/mol, XLogP of 1.52, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(dimethylamino)hepta-2,4,6-trienylidene-dimethylazanium is sourced from PubChem (CID 23278995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).