About 3-acetylbenzamide
3-acetylbenzamide (PubChem CID 23279231) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-acetylbenzamide.
Molecular Properties
| Compound Name | 3-acetylbenzamide |
| PubChem CID | 23279231 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 3-acetylbenzamide |
| SMILES | CC(=O)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C9H9NO2/c1-6(11)7-3-2-4-8(5-7)9(10)12/h2-5H,1H3,(H2,10,12) |
| InChIKey | VTBUZDRQHQPEQY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-acetylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetylbenzamide?
The IUPAC name of 3-acetylbenzamide (CID 23279231) is 3-acetylbenzamide.
What is the SMILES notation for 3-acetylbenzamide?
The canonical SMILES for 3-acetylbenzamide is CC(=O)c1cccc(C(N)=O)c1.
What is the InChIKey of 3-acetylbenzamide?
The InChIKey is VTBUZDRQHQPEQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c1-6(11)7-3-2-4-8(5-7)9(10)12/h2-5H,1H3,(H2,10,12).
What are the key properties of 3-acetylbenzamide?
3-acetylbenzamide has a molecular weight of 163.18 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetylbenzamide is sourced from PubChem (CID 23279231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).