C22H36N4+4 — CID 23279411
9,13,16,20-tetrazoniatricyclo[20.4.0.02,7]hexacosa-1(26),2,4,6,22,24-hexaene (PubChem CID 23279411) has the molecular formula C22H36N4+4 and a molecular weight of 356.56 g/mol. Its IUPAC name is 9,13,16,20-tetrazoniatricyclo[20.4.0.02,7]hexacosa-1(26),2,4,6,22,24-hexaene.
| Compound Name | 9,13,16,20-tetrazoniatricyclo[20.4.0.02,7]hexacosa-1(26),2,4,6,22,24-hexaene |
|---|---|
| PubChem CID | 23279411 |
| Molecular Formula | C22H36N4+4 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | 9,13,16,20-tetrazoniatricyclo[20.4.0.02,7]hexacosa-1(26),2,4,6,22,24-hexaene |
| SMILES | c1ccc2c(c1)C[NH2+]CCC[NH2+]CC[NH2+]CCC[NH2+]Cc1ccccc1-2 |
| InChI | InChI=1S/C22H32N4/c1-3-9-21-19(7-1)17-25-13-5-11-23-15-16-24-12-6-14-26-18-20-8-2-4-10-22(20)21/h1-4,7-10,23-26H,5-6,11-18H2/p+4 |
| InChIKey | GYCFESJXIINJGD-UHFFFAOYSA-R |
| XLogP | -1.60 |
| TPSA | 66.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |