About 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one
2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one (PubChem CID 2327942) has the molecular formula C10H6N2OS2
and a molecular weight of 234.31 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one |
| PubChem CID | 2327942 |
| Molecular Formula | C10H6N2OS2 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one |
| SMILES | O=c1c2ccccc2sn1-c1nccs1 |
| InChI | InChI=1S/C10H6N2OS2/c13-9-7-3-1-2-4-8(7)15-12(9)10-11-5-6-14-10/h1-6H |
| InChIKey | VNXHYDLIKDKGJP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one?
The IUPAC name of 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one (CID 2327942) is 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one.
What is the SMILES notation for 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one?
The canonical SMILES for 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one is O=c1c2ccccc2sn1-c1nccs1.
What is the InChIKey of 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one?
The InChIKey is VNXHYDLIKDKGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2OS2/c13-9-7-3-1-2-4-8(7)15-12(9)10-11-5-6-14-10/h1-6H.
What are the key properties of 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one?
2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one has a molecular weight of 234.31 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-yl)-1,2-benzothiazol-3-one is sourced from PubChem (CID 2327942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).